C5H10N2O2 — CID 165357138
6,7-dioxa-2,3-diazabicyclo[3.2.2]nonane (PubChem CID 165357138) has the molecular formula C5H10N2O2 and a molecular weight of 130.15 g/mol. Its IUPAC name is 6,7-dioxa-2,3-diazabicyclo[3.2.2]nonane.
| Compound Name | 6,7-dioxa-2,3-diazabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 165357138 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | 6,7-dioxa-2,3-diazabicyclo[3.2.2]nonane |
| SMILES | C1CC2NNCC1OO2 |
| InChI | InChI=1S/C5H10N2O2/c1-2-5-7-6-3-4(1)8-9-5/h4-7H,1-3H2 |
| InChIKey | WLTKFRAIQSOLKB-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|