C10H20N2 — CID 175513739
1,2,3,4,4a,5,6,7,8,9,10,10a-dodecahydrocycloocta[d]pyridazine (PubChem CID 175513739) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,9,10,10a-dodecahydrocycloocta[d]pyridazine.
| Compound Name | 1,2,3,4,4a,5,6,7,8,9,10,10a-dodecahydrocycloocta[d]pyridazine |
|---|---|
| PubChem CID | 175513739 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,9,10,10a-dodecahydrocycloocta[d]pyridazine |
| SMILES | C1CCCC2CNNCC2CC1 |
| InChI | InChI=1S/C10H20N2/c1-2-4-6-10-8-12-11-7-9(10)5-3-1/h9-12H,1-8H2 |
| InChIKey | WGXOAOJPORBFAM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |