About 4-cyclooctyldiazocane
4-cyclooctyldiazocane (PubChem CID 70528396) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is 4-cyclooctyldiazocane.
Molecular Properties
| Compound Name | 4-cyclooctyldiazocane |
| PubChem CID | 70528396 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 4-cyclooctyldiazocane |
| SMILES | C1CCCC(C2CCCCNNC2)CCC1 |
| InChI | InChI=1S/C14H28N2/c1-2-4-8-13(9-5-3-1)14-10-6-7-11-15-16-12-14/h13-16H,1-12H2 |
| InChIKey | ITTALOAGRSSUHZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclooctyldiazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclooctyldiazocane?
The IUPAC name of 4-cyclooctyldiazocane (CID 70528396) is 4-cyclooctyldiazocane.
What is the SMILES notation for 4-cyclooctyldiazocane?
The canonical SMILES for 4-cyclooctyldiazocane is C1CCCC(C2CCCCNNC2)CCC1.
What is the InChIKey of 4-cyclooctyldiazocane?
The InChIKey is ITTALOAGRSSUHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2/c1-2-4-8-13(9-5-3-1)14-10-6-7-11-15-16-12-14/h13-16H,1-12H2.
What are the key properties of 4-cyclooctyldiazocane?
4-cyclooctyldiazocane has a molecular weight of 224.39 g/mol, XLogP of 3.24, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclooctyldiazocane is sourced from PubChem (CID 70528396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).