C6H9NOS — CID 91886205
(1R,5S)-8-oxa-3-azabicyclo[3.2.1]octane-2-thione (PubChem CID 91886205) has the molecular formula C6H9NOS and a molecular weight of 143.21 g/mol. Its IUPAC name is (1R,5S)-8-oxa-3-azabicyclo[3.2.1]octane-2-thione.
| Compound Name | (1R,5S)-8-oxa-3-azabicyclo[3.2.1]octane-2-thione |
|---|---|
| PubChem CID | 91886205 |
| Molecular Formula | C6H9NOS |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | (1R,5S)-8-oxa-3-azabicyclo[3.2.1]octane-2-thione |
| SMILES | S=C1NC[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C6H9NOS/c9-6-5-2-1-4(8-5)3-7-6/h4-5H,1-3H2,(H,7,9)/t4-,5+/m0/s1 |
| InChIKey | HEAWCPGCWNVSHU-CRCLSJGQSA-N |
| XLogP | 0.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|