C6H10N2S — CID 148827081
(1S,5R)-3,8-diazabicyclo[3.2.1]octane-2-thione (PubChem CID 148827081) has the molecular formula C6H10N2S and a molecular weight of 142.23 g/mol. Its IUPAC name is (1S,5R)-3,8-diazabicyclo[3.2.1]octane-2-thione.
| Compound Name | (1S,5R)-3,8-diazabicyclo[3.2.1]octane-2-thione |
|---|---|
| PubChem CID | 148827081 |
| Molecular Formula | C6H10N2S |
| Molecular Weight | 142.23 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (1S,5R)-3,8-diazabicyclo[3.2.1]octane-2-thione |
| SMILES | S=C1NC[C@H]2CC[C@@H]1N2 |
| InChI | InChI=1S/C6H10N2S/c9-6-5-2-1-4(8-5)3-7-6/h4-5,8H,1-3H2,(H,7,9)/t4-,5+/m1/s1 |
| InChIKey | OSYCTKNNYFQXPU-UHNVWZDZSA-N |
| XLogP | 0.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|