C6H8F3NOS — CID 95970437
(2S,6S)-2-methyl-6-(trifluoromethyl)morpholine-3-thione (PubChem CID 95970437) has the molecular formula C6H8F3NOS and a molecular weight of 199.20 g/mol. Its IUPAC name is (2S,6S)-2-methyl-6-(trifluoromethyl)morpholine-3-thione.
| Compound Name | (2S,6S)-2-methyl-6-(trifluoromethyl)morpholine-3-thione |
|---|---|
| PubChem CID | 95970437 |
| Molecular Formula | C6H8F3NOS |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.03 |
| IUPAC Name | (2S,6S)-2-methyl-6-(trifluoromethyl)morpholine-3-thione |
| SMILES | C[C@@H]1O[C@H](C(F)(F)F)CNC1=S |
| InChI | InChI=1S/C6H8F3NOS/c1-3-5(12)10-2-4(11-3)6(7,8)9/h3-4H,2H2,1H3,(H,10,12)/t3-,4-/m0/s1 |
| InChIKey | YKOABZUMHXVXMH-IMJSIDKUSA-N |
| XLogP | 1.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|