C8H12F3NOS — CID 95970457
(2S,6S)-2-propan-2-yl-6-(trifluoromethyl)morpholine-3-thione (PubChem CID 95970457) has the molecular formula C8H12F3NOS and a molecular weight of 227.25 g/mol. Its IUPAC name is (2S,6S)-2-propan-2-yl-6-(trifluoromethyl)morpholine-3-thione.
| Compound Name | (2S,6S)-2-propan-2-yl-6-(trifluoromethyl)morpholine-3-thione |
|---|---|
| PubChem CID | 95970457 |
| Molecular Formula | C8H12F3NOS |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | (2S,6S)-2-propan-2-yl-6-(trifluoromethyl)morpholine-3-thione |
| SMILES | CC(C)[C@@H]1O[C@H](C(F)(F)F)CNC1=S |
| InChI | InChI=1S/C8H12F3NOS/c1-4(2)6-7(14)12-3-5(13-6)8(9,10)11/h4-6H,3H2,1-2H3,(H,12,14)/t5-,6-/m0/s1 |
| InChIKey | SKMBYDUGLMPKMN-WDSKDSINSA-N |
| XLogP | 1.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|