C12H20NO+ — CID 98163445
1-[(1S,6R)-9-oxabicyclo[4.2.1]nonan-2-ylidene]pyrrolidin-1-ium (PubChem CID 98163445) has the molecular formula C12H20NO+ and a molecular weight of 194.30 g/mol. Its IUPAC name is 1-[(1S,6R)-9-oxabicyclo[4.2.1]nonan-2-ylidene]pyrrolidin-1-ium.
| Compound Name | 1-[(1S,6R)-9-oxabicyclo[4.2.1]nonan-2-ylidene]pyrrolidin-1-ium |
|---|---|
| PubChem CID | 98163445 |
| Molecular Formula | C12H20NO+ |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-[(1S,6R)-9-oxabicyclo[4.2.1]nonan-2-ylidene]pyrrolidin-1-ium |
| SMILES | C1CC(=[N+]2CCCC2)[C@@H]2CC[C@@H](C1)O2 |
| InChI | InChI=1S/C12H20NO/c1-2-9-13(8-1)11-5-3-4-10-6-7-12(11)14-10/h10,12H,1-9H2/q+1/t10-,12+/m1/s1 |
| InChIKey | OGZUAJUBIOCFOK-PWSUYJOCSA-N |
| XLogP | 1.97 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|