C12H20NSe2+ — CID 102375377
1-(3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]diselenol-2-ylidene)piperidin-1-ium (PubChem CID 102375377) has the molecular formula C12H20NSe2+ and a molecular weight of 336.22 g/mol. Its IUPAC name is 1-(3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]diselenol-2-ylidene)piperidin-1-ium.
| Compound Name | 1-(3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]diselenol-2-ylidene)piperidin-1-ium |
|---|---|
| PubChem CID | 102375377 |
| Molecular Formula | C12H20NSe2+ |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 1-(3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]diselenol-2-ylidene)piperidin-1-ium |
| SMILES | C1CC[N+](=C2[Se]C3CCCCC3[Se]2)CC1 |
| InChI | InChI=1S/C12H20NSe2/c1-4-8-13(9-5-1)12-14-10-6-2-3-7-11(10)15-12/h10-11H,1-9H2/q+1 |
| InChIKey | MFRIPOJVMODCRR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|