C10H16NS2+ — CID 2781257
1-(4,5-dimethyl-1,3-dithiol-2-ylidene)piperidin-1-ium (PubChem CID 2781257) has the molecular formula C10H16NS2+ and a molecular weight of 214.38 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-dithiol-2-ylidene)piperidin-1-ium.
| Compound Name | 1-(4,5-dimethyl-1,3-dithiol-2-ylidene)piperidin-1-ium |
|---|---|
| PubChem CID | 2781257 |
| Molecular Formula | C10H16NS2+ |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-dithiol-2-ylidene)piperidin-1-ium |
| SMILES | Cc1sc(=[N+]2CCCCC2)sc1C |
| InChI | InChI=1S/C10H16NS2/c1-8-9(2)13-10(12-8)11-6-4-3-5-7-11/h3-7H2,1-2H3/q+1 |
| InChIKey | JZVRLAYJANIZMK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|