C18H22N2O2S4+2 — CID 90716245
2,6-di(piperidin-1-ium-1-ylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiole-4,8-diol (PubChem CID 90716245) has the molecular formula C18H22N2O2S4+2 and a molecular weight of 426.65 g/mol. Its IUPAC name is 2,6-di(piperidin-1-ium-1-ylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiole-4,8-diol.
| Compound Name | 2,6-di(piperidin-1-ium-1-ylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiole-4,8-diol |
|---|---|
| PubChem CID | 90716245 |
| Molecular Formula | C18H22N2O2S4+2 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 2,6-di(piperidin-1-ium-1-ylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiole-4,8-diol |
| SMILES | Oc1c2sc(=[N+]3CCCCC3)sc2c(O)c2sc(=[N+]3CCCCC3)sc12 |
| InChI | InChI=1S/C18H20N2O2S4/c21-11-13-14(24-17(23-13)19-7-3-1-4-8-19)12(22)16-15(11)25-18(26-16)20-9-5-2-6-10-20/h1-10H2/p+2 |
| InChIKey | VLFOSQBEZKONQB-UHFFFAOYSA-P |
| XLogP | 3.56 |
| TPSA | 46.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|