C15H18NS3+ — CID 11066780
5-(4-methylphenyl)-2-piperidin-1-ium-1-ylidene-1,3-dithiole-4-thiol (PubChem CID 11066780) has the molecular formula C15H18NS3+ and a molecular weight of 308.52 g/mol. Its IUPAC name is 5-(4-methylphenyl)-2-piperidin-1-ium-1-ylidene-1,3-dithiole-4-thiol.
| Compound Name | 5-(4-methylphenyl)-2-piperidin-1-ium-1-ylidene-1,3-dithiole-4-thiol |
|---|---|
| PubChem CID | 11066780 |
| Molecular Formula | C15H18NS3+ |
| Molecular Weight | 308.52 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 5-(4-methylphenyl)-2-piperidin-1-ium-1-ylidene-1,3-dithiole-4-thiol |
| SMILES | Cc1ccc(-c2sc(=[N+]3CCCCC3)sc2S)cc1 |
| InChI | InChI=1S/C15H17NS3/c1-11-5-7-12(8-6-11)13-14(17)19-15(18-13)16-9-3-2-4-10-16/h5-8H,2-4,9-10H2,1H3/p+1 |
| InChIKey | YWJBQRKVIKCJCN-UHFFFAOYSA-O |
| XLogP | 4.03 |
| TPSA | 3.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|