C26H20NO2S2+ — CID 76790500
21-pyrrolidin-1-ium-1-ylidene-20,22-dithiaheptacyclo[15.7.0.02,9.03,8.09,16.010,15.019,23]tetracosa-1(17),3,5,7,10,12,14,18,23-nonaene-18,24-diol (PubChem CID 76790500) has the molecular formula C26H20NO2S2+ and a molecular weight of 442.59 g/mol. Its IUPAC name is 21-pyrrolidin-1-ium-1-ylidene-20,22-dithiaheptacyclo[15.7.0.02,9.03,8.09,16.010,15.019,23]tetracosa-1(17),3,5,7,10,12,14,18,23-nonaene-18,24-diol.
| Compound Name | 21-pyrrolidin-1-ium-1-ylidene-20,22-dithiaheptacyclo[15.7.0.02,9.03,8.09,16.010,15.019,23]tetracosa-1(17),3,5,7,10,12,14,18,23-nonaene-18,24-diol |
|---|---|
| PubChem CID | 76790500 |
| Molecular Formula | C26H20NO2S2+ |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 21-pyrrolidin-1-ium-1-ylidene-20,22-dithiaheptacyclo[15.7.0.02,9.03,8.09,16.010,15.019,23]tetracosa-1(17),3,5,7,10,12,14,18,23-nonaene-18,24-diol |
| SMILES | Oc1c2c(c(O)c3sc(=[N+]4CCCC4)sc13)C1c3ccccc3C13c1ccccc1C23 |
| InChI | InChI=1S/C26H19NO2S2/c28-21-17-18(22(29)24-23(21)30-25(31-24)27-11-5-6-12-27)20-14-8-2-4-10-16(14)26(20)15-9-3-1-7-13(15)19(17)26/h1-4,7-10,19-20H,5-6,11-12H2,(H-,28,29)/p+1 |
| InChIKey | JDXMPWMPRJPGII-UHFFFAOYSA-O |
| XLogP | 4.83 |
| TPSA | 43.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|