C17H12O — CID 90482137
pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaene-9-carbaldehyde (PubChem CID 90482137) has the molecular formula C17H12O and a molecular weight of 232.28 g/mol. Its IUPAC name is pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaene-9-carbaldehyde.
| Compound Name | pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaene-9-carbaldehyde |
|---|---|
| PubChem CID | 90482137 |
| Molecular Formula | C17H12O |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaene-9-carbaldehyde |
| SMILES | O=CC12c3ccccc3C3C(c4ccccc41)C32 |
| InChI | InChI=1S/C17H12O/c18-9-17-12-7-3-1-5-10(12)14-15(16(14)17)11-6-2-4-8-13(11)17/h1-9,14-16H |
| InChIKey | MAIJIHLVZUMKDO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|