C8H12F6NPSe2 — CID 13128732
1-(1,3-diselenol-2-ylidene)piperidin-1-ium hexafluorophosphate (PubChem CID 13128732) has the molecular formula C8H12F6NPSe2 and a molecular weight of 425.07 g/mol. Its IUPAC name is 1-(1,3-diselenol-2-ylidene)piperidin-1-ium hexafluorophosphate.
| Compound Name | 1-(1,3-diselenol-2-ylidene)piperidin-1-ium hexafluorophosphate |
|---|---|
| PubChem CID | 13128732 |
| Molecular Formula | C8H12F6NPSe2 |
| Molecular Weight | 425.07 g/mol |
| Exact Mass | 426.89 |
| IUPAC Name | 1-(1,3-diselenol-2-ylidene)piperidin-1-ium hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.c1c[se]c(=[N+]2CCCCC2)[se]1 |
| InChI | InChI=1S/C8H12NSe2.F6P/c1-2-4-9(5-3-1)8-10-6-7-11-8;1-7(2,3,4,5)6/h6-7H,1-5H2;/q+1;-1 |
| InChIKey | PROSWERMSDUPHU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.07 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|