C9H16N+ — CID 12842033
1-methyl-2,3,5,6,7,8-hexahydro-1H-indolizin-4-ium (PubChem CID 12842033) has the molecular formula C9H16N+ and a molecular weight of 138.23 g/mol. Its IUPAC name is 1-methyl-2,3,5,6,7,8-hexahydro-1H-indolizin-4-ium.
| Compound Name | 1-methyl-2,3,5,6,7,8-hexahydro-1H-indolizin-4-ium |
|---|---|
| PubChem CID | 12842033 |
| Molecular Formula | C9H16N+ |
| Molecular Weight | 138.23 g/mol |
| Exact Mass | 138.13 |
| IUPAC Name | 1-methyl-2,3,5,6,7,8-hexahydro-1H-indolizin-4-ium |
| SMILES | CC1CC[N+]2=C1CCCC2 |
| InChI | InChI=1S/C9H16N/c1-8-5-7-10-6-3-2-4-9(8)10/h8H,2-7H2,1H3/q+1 |
| InChIKey | YYKHEGQSYNUFMM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|