C11H20ClNO4 — CID 134924052
1,9-dimethyl-1,2,3,4,6,7,8,9-octahydroquinolizin-5-ium perchlorate (PubChem CID 134924052) has the molecular formula C11H20ClNO4 and a molecular weight of 265.74 g/mol. Its IUPAC name is 1,9-dimethyl-1,2,3,4,6,7,8,9-octahydroquinolizin-5-ium perchlorate.
| Compound Name | 1,9-dimethyl-1,2,3,4,6,7,8,9-octahydroquinolizin-5-ium perchlorate |
|---|---|
| PubChem CID | 134924052 |
| Molecular Formula | C11H20ClNO4 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 1,9-dimethyl-1,2,3,4,6,7,8,9-octahydroquinolizin-5-ium perchlorate |
| SMILES | CC1CCC[N+]2=C1C(C)CCC2.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C11H20N.ClHO4/c1-9-5-3-7-12-8-4-6-10(2)11(9)12;2-1(3,4)5/h9-10H,3-8H2,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | WYWZQSQUILPEIL-UHFFFAOYSA-M |
| XLogP | -2.46 |
| TPSA | 95.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|