C9H15N2+ — CID 178148892
1,3-dimethyl-5,6,7,8-tetrahydro-1H-imidazo[1,5-a]pyridin-4-ium (PubChem CID 178148892) has the molecular formula C9H15N2+ and a molecular weight of 151.23 g/mol. Its IUPAC name is 1,3-dimethyl-5,6,7,8-tetrahydro-1H-imidazo[1,5-a]pyridin-4-ium.
| Compound Name | 1,3-dimethyl-5,6,7,8-tetrahydro-1H-imidazo[1,5-a]pyridin-4-ium |
|---|---|
| PubChem CID | 178148892 |
| Molecular Formula | C9H15N2+ |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.12 |
| IUPAC Name | 1,3-dimethyl-5,6,7,8-tetrahydro-1H-imidazo[1,5-a]pyridin-4-ium |
| SMILES | CC1=NC(C)C2=[N+]1CCCC2 |
| InChI | InChI=1S/C9H15N2/c1-7-9-5-3-4-6-11(9)8(2)10-7/h7H,3-6H2,1-2H3/q+1 |
| InChIKey | CDMLETBZADLWMZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|