C15H21N2O+ — CID 170407270
2-phenoxy-2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium (PubChem CID 170407270) has the molecular formula C15H21N2O+ and a molecular weight of 245.35 g/mol. Its IUPAC name is 2-phenoxy-2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium.
| Compound Name | 2-phenoxy-2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium |
|---|---|
| PubChem CID | 170407270 |
| Molecular Formula | C15H21N2O+ |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 2-phenoxy-2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium |
| SMILES | c1ccc(OC2CC[N+]3=C(CCCCC3)N2)cc1 |
| InChI | InChI=1S/C15H20N2O/c1-3-7-13(8-4-1)18-15-10-12-17-11-6-2-5-9-14(17)16-15/h1,3-4,7-8,15H,2,5-6,9-12H2/p+1 |
| InChIKey | AUBYXZJBDGCPDH-UHFFFAOYSA-O |
| XLogP | 2.37 |
| TPSA | 24.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|