C21H26ClN2O3P — CID 11122666
10-diphenoxyphosphoryl-2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium chloride (PubChem CID 11122666) has the molecular formula C21H26ClN2O3P and a molecular weight of 420.88 g/mol. Its IUPAC name is 10-diphenoxyphosphoryl-2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium chloride.
| Compound Name | 10-diphenoxyphosphoryl-2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium chloride |
|---|---|
| PubChem CID | 11122666 |
| Molecular Formula | C21H26ClN2O3P |
| Molecular Weight | 420.88 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 10-diphenoxyphosphoryl-2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium chloride |
| SMILES | O=P(Oc1ccccc1)(Oc1ccccc1)C1CCCC[N+]2=C1NCCC2.[Cl-] |
| InChI | InChI=1S/C21H25N2O3P.ClH/c24-27(25-18-10-3-1-4-11-18,26-19-12-5-2-6-13-19)20-14-7-8-16-23-17-9-15-22-21(20)23;/h1-6,10-13,20H,7-9,14-17H2;1H |
| InChIKey | AVCVUWNGPNVITC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 50.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.88 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|