C8H4N2 — CID 165358181
2,4,6-trideuteriobenzene-1,3-dicarbonitrile (PubChem CID 165358181) has the molecular formula C8H4N2 and a molecular weight of 131.15 g/mol. Its IUPAC name is 2,4,6-trideuteriobenzene-1,3-dicarbonitrile.
| Compound Name | 2,4,6-trideuteriobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 165358181 |
| Molecular Formula | C8H4N2 |
| Molecular Weight | 131.15 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | 2,4,6-trideuteriobenzene-1,3-dicarbonitrile |
| SMILES | [2H]c1cc([2H])c(C#N)c([2H])c1C#N |
| InChI | InChI=1S/C8H4N2/c9-5-7-2-1-3-8(4-7)6-10/h1-4H/i2D,3D,4D |
| InChIKey | LAQPNDIUHRHNCV-NRUYWUNFSA-N |
| XLogP | 1.43 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.15 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |