C9H9NO — CID 53496781
4-hydroxy-3,5-bis(trideuteriomethyl)benzonitrile (PubChem CID 53496781) has the molecular formula C9H9NO and a molecular weight of 153.21 g/mol. Its IUPAC name is 4-hydroxy-3,5-bis(trideuteriomethyl)benzonitrile.
| Compound Name | 4-hydroxy-3,5-bis(trideuteriomethyl)benzonitrile |
|---|---|
| PubChem CID | 53496781 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.11 |
| IUPAC Name | 4-hydroxy-3,5-bis(trideuteriomethyl)benzonitrile |
| SMILES | [2H]C([2H])([2H])c1cc(C#N)cc(C([2H])([2H])[2H])c1O |
| InChI | InChI=1S/C9H9NO/c1-6-3-8(5-10)4-7(2)9(6)11/h3-4,11H,1-2H3/i1D3,2D3 |
| InChIKey | WFYGXOWFEIOHCZ-WFGJKAKNSA-N |
| XLogP | 1.88 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |