C11H13NO — CID 117277250
3-(1-hydroxyethyl)-4,5-dimethylbenzonitrile (PubChem CID 117277250) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 3-(1-hydroxyethyl)-4,5-dimethylbenzonitrile.
| Compound Name | 3-(1-hydroxyethyl)-4,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 117277250 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 3-(1-hydroxyethyl)-4,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C(C)O)c1C |
| InChI | InChI=1S/C11H13NO/c1-7-4-10(6-12)5-11(8(7)2)9(3)13/h4-5,9,13H,1-3H3 |
| InChIKey | UUMWXHJXMWVONX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |