C23H30O8 — CID 165368423
methyl (4S,5R)-5-[(2S)-butan-2-yl]-4-[(E)-7-(2,6-dioxocyclohexylidene)-7-hydroxy-4-methylidenehept-1-enyl]-2-oxo-1,3-dioxolane-4-carboxylate (PubChem CID 165368423) has the molecular formula C23H30O8 and a molecular weight of 434.49 g/mol. Its IUPAC name is methyl (4S,5R)-5-[(2S)-butan-2-yl]-4-[(E)-7-(2,6-dioxocyclohexylidene)-7-hydroxy-4-methylidenehept-1-enyl]-2-oxo-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (4S,5R)-5-[(2S)-butan-2-yl]-4-[(E)-7-(2,6-dioxocyclohexylidene)-7-hydroxy-4-methylidenehept-1-enyl]-2-oxo-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 165368423 |
| Molecular Formula | C23H30O8 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | methyl (4S,5R)-5-[(2S)-butan-2-yl]-4-[(E)-7-(2,6-dioxocyclohexylidene)-7-hydroxy-4-methylidenehept-1-enyl]-2-oxo-1,3-dioxolane-4-carboxylate |
| SMILES | C=C(C/C=C/[C@]1(C(=O)OC)OC(=O)O[C@@H]1[C@@H](C)CC)CCC(O)=C1C(=O)CCCC1=O |
| InChI | InChI=1S/C23H30O8/c1-5-15(3)20-23(21(27)29-4,31-22(28)30-20)13-7-8-14(2)11-12-18(26)19-16(24)9-6-10-17(19)25/h7,13,15,20,26H,2,5-6,8-12H2,1,3-4H3/b13-7+/t15-,20+,23-/m0/s1 |
| InChIKey | GTTGPVZFUGZYJA-CUDJXBHKSA-N |
| XLogP | 3.90 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|