C24H32O9 — CID 165368421
methyl (4S,5R)-5-[(2S)-butan-2-yl]-4-[(E,7E)-7-[(6R)-6-ethyl-2,4-dioxooxan-3-ylidene]-7-hydroxy-4-methylidenehept-1-enyl]-2-oxo-1,3-dioxolane-4-carboxylate (PubChem CID 165368421) has the molecular formula C24H32O9 and a molecular weight of 464.51 g/mol. Its IUPAC name is methyl (4S,5R)-5-[(2S)-butan-2-yl]-4-[(E,7E)-7-[(6R)-6-ethyl-2,4-dioxooxan-3-ylidene]-7-hydroxy-4-methylidenehept-1-enyl]-2-oxo-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (4S,5R)-5-[(2S)-butan-2-yl]-4-[(E,7E)-7-[(6R)-6-ethyl-2,4-dioxooxan-3-ylidene]-7-hydroxy-4-methylidenehept-1-enyl]-2-oxo-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 165368421 |
| Molecular Formula | C24H32O9 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | methyl (4S,5R)-5-[(2S)-butan-2-yl]-4-[(E,7E)-7-[(6R)-6-ethyl-2,4-dioxooxan-3-ylidene]-7-hydroxy-4-methylidenehept-1-enyl]-2-oxo-1,3-dioxolane-4-carboxylate |
| SMILES | C=C(C/C=C/[C@]1(C(=O)OC)OC(=O)O[C@@H]1[C@@H](C)CC)CC/C(O)=C1/C(=O)C[C@@H](CC)OC1=O |
| InChI | InChI=1S/C24H32O9/c1-6-15(4)20-24(22(28)30-5,33-23(29)32-20)12-8-9-14(3)10-11-17(25)19-18(26)13-16(7-2)31-21(19)27/h8,12,15-16,20,25H,3,6-7,9-11,13H2,1-2,4-5H3/b12-8+,19-17+/t15-,16+,20+,24-/m0/s1 |
| InChIKey | ODBPXSKDBDZTLV-QAJVEVTJSA-N |
| XLogP | 3.87 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|