C22H28O9 — CID 165368420
methyl (4S,5R)-5-[(2S)-butan-2-yl]-4-[(E,7E)-7-(2,4-dioxooxan-3-ylidene)-7-hydroxy-4-methylidenehept-1-enyl]-2-oxo-1,3-dioxolane-4-carboxylate (PubChem CID 165368420) has the molecular formula C22H28O9 and a molecular weight of 436.46 g/mol. Its IUPAC name is methyl (4S,5R)-5-[(2S)-butan-2-yl]-4-[(E,7E)-7-(2,4-dioxooxan-3-ylidene)-7-hydroxy-4-methylidenehept-1-enyl]-2-oxo-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (4S,5R)-5-[(2S)-butan-2-yl]-4-[(E,7E)-7-(2,4-dioxooxan-3-ylidene)-7-hydroxy-4-methylidenehept-1-enyl]-2-oxo-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 165368420 |
| Molecular Formula | C22H28O9 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | methyl (4S,5R)-5-[(2S)-butan-2-yl]-4-[(E,7E)-7-(2,4-dioxooxan-3-ylidene)-7-hydroxy-4-methylidenehept-1-enyl]-2-oxo-1,3-dioxolane-4-carboxylate |
| SMILES | C=C(C/C=C/[C@]1(C(=O)OC)OC(=O)O[C@@H]1[C@@H](C)CC)CC/C(O)=C1/C(=O)CCOC1=O |
| InChI | InChI=1S/C22H28O9/c1-5-14(3)18-22(20(26)28-4,31-21(27)30-18)11-6-7-13(2)8-9-15(23)17-16(24)10-12-29-19(17)25/h6,11,14,18,23H,2,5,7-10,12H2,1,3-4H3/b11-6+,17-15+/t14-,18+,22-/m0/s1 |
| InChIKey | VOTUOIRMLXEOKQ-OOLWLKSQSA-N |
| XLogP | 3.09 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|