C24H38O6 — CID 54691258
(3E,6R)-3-[(E,4R)-7-[(4R,5S)-4-[(2S)-butan-2-yl]-2,2-dimethyl-1,3-dioxan-5-yl]-1-hydroxy-4-methylhept-6-enylidene]-6-methyloxane-2,4-dione (PubChem CID 54691258) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is (3E,6R)-3-[(E,4R)-7-[(4R,5S)-4-[(2S)-butan-2-yl]-2,2-dimethyl-1,3-dioxan-5-yl]-1-hydroxy-4-methylhept-6-enylidene]-6-methyloxane-2,4-dione.
| Compound Name | (3E,6R)-3-[(E,4R)-7-[(4R,5S)-4-[(2S)-butan-2-yl]-2,2-dimethyl-1,3-dioxan-5-yl]-1-hydroxy-4-methylhept-6-enylidene]-6-methyloxane-2,4-dione |
|---|---|
| PubChem CID | 54691258 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | (3E,6R)-3-[(E,4R)-7-[(4R,5S)-4-[(2S)-butan-2-yl]-2,2-dimethyl-1,3-dioxan-5-yl]-1-hydroxy-4-methylhept-6-enylidene]-6-methyloxane-2,4-dione |
| SMILES | CC[C@H](C)[C@H]1OC(C)(C)OC[C@@H]1/C=C/C[C@H](C)CC/C(O)=C1/C(=O)C[C@@H](C)OC1=O |
| InChI | InChI=1S/C24H38O6/c1-7-16(3)22-18(14-28-24(5,6)30-22)10-8-9-15(2)11-12-19(25)21-20(26)13-17(4)29-23(21)27/h8,10,15-18,22,25H,7,9,11-14H2,1-6H3/b10-8+,21-19+/t15-,16-,17+,18-,22+/m0/s1 |
| InChIKey | RYBCGVZGKWZGIA-MTSKGAHRSA-N |
| XLogP | 4.88 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|