C17H17FN4 — CID 165371440
N-(2-tert-butyl-5-fluoro-4-pyridinyl)-1,5-naphthyridin-2-amine (PubChem CID 165371440) has the molecular formula C17H17FN4 and a molecular weight of 296.35 g/mol. Its IUPAC name is N-(2-tert-butyl-5-fluoro-4-pyridinyl)-1,5-naphthyridin-2-amine.
| Compound Name | N-(2-tert-butyl-5-fluoro-4-pyridinyl)-1,5-naphthyridin-2-amine |
|---|---|
| PubChem CID | 165371440 |
| Molecular Formula | C17H17FN4 |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-(2-tert-butyl-5-fluoro-4-pyridinyl)-1,5-naphthyridin-2-amine |
| SMILES | CC(C)(C)c1cc(Nc2ccc3ncccc3n2)c(F)cn1 |
| InChI | InChI=1S/C17H17FN4/c1-17(2,3)15-9-14(11(18)10-20-15)22-16-7-6-12-13(21-16)5-4-8-19-12/h4-10H,1-3H3,(H,20,21,22) |
| InChIKey | YIXXJBXTYHNPEV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |