C17H28N2 — CID 165372455
2-(2,4-dimethylpentan-3-yl)-5-piperidin-1-ylpyridine (PubChem CID 165372455) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is 2-(2,4-dimethylpentan-3-yl)-5-piperidin-1-ylpyridine.
| Compound Name | 2-(2,4-dimethylpentan-3-yl)-5-piperidin-1-ylpyridine |
|---|---|
| PubChem CID | 165372455 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 2-(2,4-dimethylpentan-3-yl)-5-piperidin-1-ylpyridine |
| SMILES | CC(C)C(c1ccc(N2CCCCC2)cn1)C(C)C |
| InChI | InChI=1S/C17H28N2/c1-13(2)17(14(3)4)16-9-8-15(12-18-16)19-10-6-5-7-11-19/h8-9,12-14,17H,5-7,10-11H2,1-4H3 |
| InChIKey | MIQROHHIWHHBST-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |