About CID 165375176
CID 165375176 (PubChem CID 165375176) has the molecular formula C46H24N6O2Pt-2
and a molecular weight of 887.82 g/mol.
Molecular Properties
| Compound Name | CID 165375176 |
| PubChem CID | 165375176 |
| Molecular Formula | C46H24N6O2Pt-2 |
| Molecular Weight | 887.82 g/mol |
| Exact Mass | 887.16 |
| IUPAC Name | — |
| SMILES | C[n+]1[c-]n2c3c(cccc31)C1(c3ccc(Oc4[c-]c5c(cc4)c4ccccc4n5-c4ccccn4)[c-]c3-2)c2c(C#N)cccc2Oc2cccc(C#N)c21.[Pt] |
| InChI | InChI=1S/C46H24N6O2.Pt/c1-50-27-51-39-24-31(53-30-18-20-33-32-11-2-3-13-36(32)52(38(33)23-30)42-17-4-5-22-49-42)19-21-34(39)46(35-12-8-14-37(50)45(35)51)43-28(25-47)9-6-15-40(43)54-41-16-7-10-29(26-48)44(41)46;/h2-22H,1H3;/q-2; |
| InChIKey | ATEBXJPODQDAAY-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 92.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 887.82 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 165375176 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165375176?
The IUPAC name of CID 165375176 (CID 165375176) is not available.
What is the SMILES notation for CID 165375176?
The canonical SMILES for CID 165375176 is C[n+]1[c-]n2c3c(cccc31)C1(c3ccc(Oc4[c-]c5c(cc4)c4ccccc4n5-c4ccccn4)[c-]c3-2)c2c(C#N)cccc2Oc2cccc(C#N)c21.[Pt].
What is the InChIKey of CID 165375176?
The InChIKey is ATEBXJPODQDAAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H24N6O2.Pt/c1-50-27-51-39-24-31(53-30-18-20-33-32-11-2-3-13-36(32)52(38(33)23-30)42-17-4-5-22-49-42)19-21-34(39)46(35-12-8-14-37(50)45(35)51)43-28(25-47)9-6-15-40(43)54-41-16-7-10-29(26-48)44(41)46;/h2-22H,1H3;/q-2;.
What are the key properties of CID 165375176?
CID 165375176 has a molecular weight of 887.82 g/mol, XLogP of 8.68, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165375176 is sourced from PubChem (CID 165375176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).