C37H21N5OPt-2 — CID 162465198
4-(3-phenyl-2H-benzimidazol-1-ium-2-id-1-yl)-2-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]benzene-3-ide-1-carbonitrile;platinum (PubChem CID 162465198) has the molecular formula C37H21N5OPt-2 and a molecular weight of 746.69 g/mol. Its IUPAC name is 4-(3-phenyl-2H-benzimidazol-1-ium-2-id-1-yl)-2-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]benzene-3-ide-1-carbonitrile;platinum.
| Compound Name | 4-(3-phenyl-2H-benzimidazol-1-ium-2-id-1-yl)-2-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]benzene-3-ide-1-carbonitrile;platinum |
|---|---|
| PubChem CID | 162465198 |
| Molecular Formula | C37H21N5OPt-2 |
| Molecular Weight | 746.69 g/mol |
| Exact Mass | 746.14 |
| IUPAC Name | 4-(3-phenyl-2H-benzimidazol-1-ium-2-id-1-yl)-2-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]benzene-3-ide-1-carbonitrile;platinum |
| SMILES | N#Cc1ccc(-[n+]2[c-]n(-c3ccccc3)c3ccccc32)[c-]c1Oc1[c-]c2c(cc1)c1ccccc1n2-c1ccccn1.[Pt] |
| InChI | InChI=1S/C37H21N5O.Pt/c38-24-26-17-18-28(41-25-40(27-10-2-1-3-11-27)33-14-6-7-15-34(33)41)22-36(26)43-29-19-20-31-30-12-4-5-13-32(30)42(35(31)23-29)37-16-8-9-21-39-37;/h1-21H;/q-2; |
| InChIKey | DQEFKRWHOZFLAM-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 59.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.69 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|