About CID 176844593
CID 176844593 (PubChem CID 176844593) has the molecular formula C62H40N6OPt-2
and a molecular weight of 1080.12 g/mol.
Molecular Properties
| Compound Name | CID 176844593 |
| PubChem CID | 176844593 |
| Molecular Formula | C62H40N6OPt-2 |
| Molecular Weight | 1080.12 g/mol |
| Exact Mass | 1079.29 |
| IUPAC Name | — |
| SMILES | Cn1c2ccccc2c2c3c4ccc(Oc5[c-]c(-[n+]6[c-]n(-c7c(-c8ccccc8)cccc7-c7ccccc7)c7ccccc76)ccc5)[c-]c4n(-c4ccccn4)c3c3c4ccccc4n(C)c3c21.[Pt] |
| InChI | InChI=1S/C62H40N6O.Pt/c1-64-50-29-11-9-25-47(50)57-56-49-35-34-44(38-54(49)68(55-33-15-16-36-63-55)60(56)58-48-26-10-12-30-51(48)65(2)62(58)61(57)64)69-43-24-17-23-42(37-43)66-39-67(53-32-14-13-31-52(53)66)59-45(40-19-5-3-6-20-40)27-18-28-46(59)41-21-7-4-8-22-41;/h3-36H,1-2H3;/q-2; |
| InChIKey | FFDKGDKRLNNLMV-UHFFFAOYSA-N |
| XLogP | 14.21 |
| TPSA | 45.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 70 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1080.12 |
| LogP ≤ 5 | 14.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 176844593 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176844593?
The IUPAC name of CID 176844593 (CID 176844593) is not available.
What is the SMILES notation for CID 176844593?
The canonical SMILES for CID 176844593 is Cn1c2ccccc2c2c3c4ccc(Oc5[c-]c(-[n+]6[c-]n(-c7c(-c8ccccc8)cccc7-c7ccccc7)c7ccccc76)ccc5)[c-]c4n(-c4ccccn4)c3c3c4ccccc4n(C)c3c21.[Pt].
What is the InChIKey of CID 176844593?
The InChIKey is FFDKGDKRLNNLMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C62H40N6O.Pt/c1-64-50-29-11-9-25-47(50)57-56-49-35-34-44(38-54(49)68(55-33-15-16-36-63-55)60(56)58-48-26-10-12-30-51(48)65(2)62(58)61(57)64)69-43-24-17-23-42(37-43)66-39-67(53-32-14-13-31-52(53)66)59-45(40-19-5-3-6-20-40)27-18-28-46(59)41-21-7-4-8-22-41;/h3-36H,1-2H3;/q-2;.
What are the key properties of CID 176844593?
CID 176844593 has a molecular weight of 1080.12 g/mol, XLogP of 14.21, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176844593 is sourced from PubChem (CID 176844593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).