About CID 176844597
CID 176844597 (PubChem CID 176844597) has the molecular formula C63H40N6OPt-2
and a molecular weight of 1092.13 g/mol.
Molecular Properties
| Compound Name | CID 176844597 |
| PubChem CID | 176844597 |
| Molecular Formula | C63H40N6OPt-2 |
| Molecular Weight | 1092.13 g/mol |
| Exact Mass | 1091.29 |
| IUPAC Name | — |
| SMILES | Cn1c2ccccc2c2c3c4ccc(Oc5[c-]c(-[n+]6[c-]n(-c7c(-c8ccccc8)cccc7-c7ccccc7)cc6)ccc5)[c-]c4n(-c4ccccn4)c3c3c(c4ccccc4n3-c3ccccc3)c21.[Pt] |
| InChI | InChI=1S/C63H40N6O.Pt/c1-65-53-31-13-11-27-50(53)57-58-52-35-34-47(40-55(52)69(56-33-15-16-36-64-56)62(58)63-59(61(57)65)51-28-12-14-32-54(51)68(63)44-23-9-4-10-24-44)70-46-26-17-25-45(39-46)66-37-38-67(41-66)60-48(42-19-5-2-6-20-42)29-18-30-49(60)43-21-7-3-8-22-43;/h2-38H,1H3;/q-2; |
| InChIKey | MQHMJLTUYPVCIA-UHFFFAOYSA-N |
| XLogP | 14.51 |
| TPSA | 45.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 71 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1092.13 |
| LogP ≤ 5 | 14.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 176844597 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176844597?
The IUPAC name of CID 176844597 (CID 176844597) is not available.
What is the SMILES notation for CID 176844597?
The canonical SMILES for CID 176844597 is Cn1c2ccccc2c2c3c4ccc(Oc5[c-]c(-[n+]6[c-]n(-c7c(-c8ccccc8)cccc7-c7ccccc7)cc6)ccc5)[c-]c4n(-c4ccccn4)c3c3c(c4ccccc4n3-c3ccccc3)c21.[Pt].
What is the InChIKey of CID 176844597?
The InChIKey is MQHMJLTUYPVCIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C63H40N6O.Pt/c1-65-53-31-13-11-27-50(53)57-58-52-35-34-47(40-55(52)69(56-33-15-16-36-64-56)62(58)63-59(61(57)65)51-28-12-14-32-54(51)68(63)44-23-9-4-10-24-44)70-46-26-17-25-45(39-46)66-37-38-67(41-66)60-48(42-19-5-2-6-20-42)29-18-30-49(60)43-21-7-3-8-22-43;/h2-38H,1H3;/q-2;.
What are the key properties of CID 176844597?
CID 176844597 has a molecular weight of 1092.13 g/mol, XLogP of 14.51, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176844597 is sourced from PubChem (CID 176844597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).