About CID 176844702
CID 176844702 (PubChem CID 176844702) has the molecular formula C54H40N6OPt-2
and a molecular weight of 984.03 g/mol.
Molecular Properties
| Compound Name | CID 176844702 |
| PubChem CID | 176844702 |
| Molecular Formula | C54H40N6OPt-2 |
| Molecular Weight | 984.03 g/mol |
| Exact Mass | 983.29 |
| IUPAC Name | — |
| SMILES | Cn1[c-][n+](-c2[c-]c(Oc3[c-]c4c(cc3)c3c5c(c6ccccc6n5C)c5c(c6ccccc6n5-c5ccccc5)c3n4-c3cc(C(C)(C)C)ccn3)ccc2)c2ccccc21.[Pt] |
| InChI | InChI=1S/C54H40N6O.Pt/c1-54(2,3)34-28-29-55-47(30-34)60-46-32-38(61-37-19-15-18-36(31-37)58-33-56(4)44-24-13-14-25-45(44)58)26-27-41(46)49-51-48(39-20-9-11-22-42(39)57(51)5)52-50(53(49)60)40-21-10-12-23-43(40)59(52)35-16-7-6-8-17-35;/h6-30H,1-5H3;/q-2; |
| InChIKey | ALOLHVIBMVJIGO-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 45.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 984.03 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 176844702 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176844702?
The IUPAC name of CID 176844702 (CID 176844702) is not available.
What is the SMILES notation for CID 176844702?
The canonical SMILES for CID 176844702 is Cn1[c-][n+](-c2[c-]c(Oc3[c-]c4c(cc3)c3c5c(c6ccccc6n5C)c5c(c6ccccc6n5-c5ccccc5)c3n4-c3cc(C(C)(C)C)ccn3)ccc2)c2ccccc21.[Pt].
What is the InChIKey of CID 176844702?
The InChIKey is ALOLHVIBMVJIGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C54H40N6O.Pt/c1-54(2,3)34-28-29-55-47(30-34)60-46-32-38(61-37-19-15-18-36(31-37)58-33-56(4)44-24-13-14-25-45(44)58)26-27-41(46)49-51-48(39-20-9-11-22-42(39)57(51)5)52-50(53(49)60)40-21-10-12-23-43(40)59(52)35-16-7-6-8-17-35;/h6-30H,1-5H3;/q-2;.
What are the key properties of CID 176844702?
CID 176844702 has a molecular weight of 984.03 g/mol, XLogP of 12.18, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176844702 is sourced from PubChem (CID 176844702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).