C17H21NO3 — CID 165377814
1-(1-acetyl-7-methoxyindolizin-3-yl)-3,3-dimethylbutan-1-one (PubChem CID 165377814) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-(1-acetyl-7-methoxyindolizin-3-yl)-3,3-dimethylbutan-1-one.
| Compound Name | 1-(1-acetyl-7-methoxyindolizin-3-yl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 165377814 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1-(1-acetyl-7-methoxyindolizin-3-yl)-3,3-dimethylbutan-1-one |
| SMILES | COc1ccn2c(C(=O)CC(C)(C)C)cc(C(C)=O)c2c1 |
| InChI | InChI=1S/C17H21NO3/c1-11(19)13-9-15(16(20)10-17(2,3)4)18-7-6-12(21-5)8-14(13)18/h6-9H,10H2,1-5H3 |
| InChIKey | LMNYHEMMQDZFBV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |