C20H27F3N2O2 — CID 165379126
6-[(3-ethoxypiperidin-1-yl)methyl]-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one (PubChem CID 165379126) has the molecular formula C20H27F3N2O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 6-[(3-ethoxypiperidin-1-yl)methyl]-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one.
| Compound Name | 6-[(3-ethoxypiperidin-1-yl)methyl]-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 165379126 |
| Molecular Formula | C20H27F3N2O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 6-[(3-ethoxypiperidin-1-yl)methyl]-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one |
| SMILES | CCOC1CCCN(Cc2cc3c(c(C(F)(F)F)c2)CN(C(C)C)C3=O)C1 |
| InChI | InChI=1S/C20H27F3N2O2/c1-4-27-15-6-5-7-24(11-15)10-14-8-16-17(18(9-14)20(21,22)23)12-25(13(2)3)19(16)26/h8-9,13,15H,4-7,10-12H2,1-3H3 |
| InChIKey | CZYGVEZMCYUAHX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |