About 6-(4,4-difluorocycloheptyl)oxy-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one
6-(4,4-difluorocycloheptyl)oxy-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one (PubChem CID 165379239) has the molecular formula C19H22F5NO2
and a molecular weight of 391.38 g/mol. Its IUPAC name is 6-(4,4-difluorocycloheptyl)oxy-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 6-(4,4-difluorocycloheptyl)oxy-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one |
| PubChem CID | 165379239 |
| Molecular Formula | C19H22F5NO2 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 6-(4,4-difluorocycloheptyl)oxy-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one |
| SMILES | CC(C)N1Cc2c(cc(OC3CCCC(F)(F)CC3)cc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C19H22F5NO2/c1-11(2)25-10-15-14(17(25)26)8-13(9-16(15)19(22,23)24)27-12-4-3-6-18(20,21)7-5-12/h8-9,11-12H,3-7,10H2,1-2H3 |
| InChIKey | DXPYMSCHIGMKMN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(4,4-difluorocycloheptyl)oxy-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4,4-difluorocycloheptyl)oxy-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one?
The IUPAC name of 6-(4,4-difluorocycloheptyl)oxy-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one (CID 165379239) is 6-(4,4-difluorocycloheptyl)oxy-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one.
What is the SMILES notation for 6-(4,4-difluorocycloheptyl)oxy-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one?
The canonical SMILES for 6-(4,4-difluorocycloheptyl)oxy-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one is CC(C)N1Cc2c(cc(OC3CCCC(F)(F)CC3)cc2C(F)(F)F)C1=O.
What is the InChIKey of 6-(4,4-difluorocycloheptyl)oxy-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one?
The InChIKey is DXPYMSCHIGMKMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22F5NO2/c1-11(2)25-10-15-14(17(25)26)8-13(9-16(15)19(22,23)24)27-12-4-3-6-18(20,21)7-5-12/h8-9,11-12H,3-7,10H2,1-2H3.
What are the key properties of 6-(4,4-difluorocycloheptyl)oxy-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one?
6-(4,4-difluorocycloheptyl)oxy-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one has a molecular weight of 391.38 g/mol, XLogP of 5.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4,4-difluorocycloheptyl)oxy-2-propan-2-yl-4-(trifluoromethyl)-3H-isoindol-1-one is sourced from PubChem (CID 165379239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).