C13H12F3O6P — CID 170166247
[6-cyclobutyloxy-3-oxo-4-(trifluoromethyl)-1H-2-benzofuran-1-yl]phosphonic acid (PubChem CID 170166247) has the molecular formula C13H12F3O6P and a molecular weight of 352.20 g/mol. Its IUPAC name is [6-cyclobutyloxy-3-oxo-4-(trifluoromethyl)-1H-2-benzofuran-1-yl]phosphonic acid.
| Compound Name | [6-cyclobutyloxy-3-oxo-4-(trifluoromethyl)-1H-2-benzofuran-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 170166247 |
| Molecular Formula | C13H12F3O6P |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | [6-cyclobutyloxy-3-oxo-4-(trifluoromethyl)-1H-2-benzofuran-1-yl]phosphonic acid |
| SMILES | O=C1OC(P(=O)(O)O)c2cc(OC3CCC3)cc(C(F)(F)F)c21 |
| InChI | InChI=1S/C13H12F3O6P/c14-13(15,16)9-5-7(21-6-2-1-3-6)4-8-10(9)11(17)22-12(8)23(18,19)20/h4-6,12H,1-3H2,(H2,18,19,20) |
| InChIKey | DMANQTYKPHKHBT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|