C23H24F3N5O3 — CID 165380857
2-[[5-(2-aminopropan-2-yl)-8-(2,2,2-trifluoroethoxy)-2,7-naphthyridin-3-yl]amino]-7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one (PubChem CID 165380857) has the molecular formula C23H24F3N5O3 and a molecular weight of 475.47 g/mol. Its IUPAC name is 2-[[5-(2-aminopropan-2-yl)-8-(2,2,2-trifluoroethoxy)-2,7-naphthyridin-3-yl]amino]-7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one.
| Compound Name | 2-[[5-(2-aminopropan-2-yl)-8-(2,2,2-trifluoroethoxy)-2,7-naphthyridin-3-yl]amino]-7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 165380857 |
| Molecular Formula | C23H24F3N5O3 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 2-[[5-(2-aminopropan-2-yl)-8-(2,2,2-trifluoroethoxy)-2,7-naphthyridin-3-yl]amino]-7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one |
| SMILES | CC1(C)Cc2nc(Nc3cc4c(C(C)(C)N)cnc(OCC(F)(F)F)c4cn3)ccc2C(=O)O1 |
| InChI | InChI=1S/C23H24F3N5O3/c1-21(2)8-16-12(20(32)34-21)5-6-17(30-16)31-18-7-13-14(9-28-18)19(33-11-23(24,25)26)29-10-15(13)22(3,4)27/h5-7,9-10H,8,11,27H2,1-4H3,(H,28,30,31) |
| InChIKey | WOOIXYKVIADLQW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |