C22H29N5O5S — CID 165384477
1-[(2S)-4-methyl-1-[2-methylsulfinylcarbonyl-2-[[(3S)-2-oxopyrrolidin-3-yl]methyl]hydrazinyl]-1-oxopentan-2-yl]indole-2-carboxamide (PubChem CID 165384477) has the molecular formula C22H29N5O5S and a molecular weight of 475.57 g/mol. Its IUPAC name is 1-[(2S)-4-methyl-1-[2-methylsulfinylcarbonyl-2-[[(3S)-2-oxopyrrolidin-3-yl]methyl]hydrazinyl]-1-oxopentan-2-yl]indole-2-carboxamide.
| Compound Name | 1-[(2S)-4-methyl-1-[2-methylsulfinylcarbonyl-2-[[(3S)-2-oxopyrrolidin-3-yl]methyl]hydrazinyl]-1-oxopentan-2-yl]indole-2-carboxamide |
|---|---|
| PubChem CID | 165384477 |
| Molecular Formula | C22H29N5O5S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 1-[(2S)-4-methyl-1-[2-methylsulfinylcarbonyl-2-[[(3S)-2-oxopyrrolidin-3-yl]methyl]hydrazinyl]-1-oxopentan-2-yl]indole-2-carboxamide |
| SMILES | CC(C)C[C@@H](C(=O)NN(C[C@@H]1CCNC1=O)C(=O)S(C)=O)n1c(C(N)=O)cc2ccccc21 |
| InChI | InChI=1S/C22H29N5O5S/c1-13(2)10-18(27-16-7-5-4-6-14(16)11-17(27)19(23)28)21(30)25-26(22(31)33(3)32)12-15-8-9-24-20(15)29/h4-7,11,13,15,18H,8-10,12H2,1-3H3,(H2,23,28)(H,24,29)(H,25,30)/t15-,18-,33?/m0/s1 |
| InChIKey | ZELYXQXQUIQEHV-IKJBJCPUSA-N |
| XLogP | 1.30 |
| TPSA | 143.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|