C16H25N3O6 — CID 165386974
(2S)-2-[[(2S)-2-amino-4-(2-methylprop-2-enoylamino)butanoyl]amino]-4-(2-methylprop-2-enoyloxy)butanoic acid (PubChem CID 165386974) has the molecular formula C16H25N3O6 and a molecular weight of 355.39 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-4-(2-methylprop-2-enoylamino)butanoyl]amino]-4-(2-methylprop-2-enoyloxy)butanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-4-(2-methylprop-2-enoylamino)butanoyl]amino]-4-(2-methylprop-2-enoyloxy)butanoic acid |
|---|---|
| PubChem CID | 165386974 |
| Molecular Formula | C16H25N3O6 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-4-(2-methylprop-2-enoylamino)butanoyl]amino]-4-(2-methylprop-2-enoyloxy)butanoic acid |
| SMILES | C=C(C)C(=O)NCC[C@H](N)C(=O)N[C@@H](CCOC(=O)C(=C)C)C(=O)O |
| InChI | InChI=1S/C16H25N3O6/c1-9(2)13(20)18-7-5-11(17)14(21)19-12(15(22)23)6-8-25-16(24)10(3)4/h11-12H,1,3,5-8,17H2,2,4H3,(H,18,20)(H,19,21)(H,22,23)/t11-,12-/m0/s1 |
| InChIKey | UMWZJPJNDYEDNP-RYUDHWBXSA-N |
| XLogP | -0.53 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|