C12H11ClN4O2S — CID 165390425
5-(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)thiophene-2-carbaldehyde (PubChem CID 165390425) has the molecular formula C12H11ClN4O2S and a molecular weight of 310.77 g/mol. Its IUPAC name is 5-(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)thiophene-2-carbaldehyde.
| Compound Name | 5-(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 165390425 |
| Molecular Formula | C12H11ClN4O2S |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 5-(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)thiophene-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2nc(Cl)nc(N3CCOCC3)n2)s1 |
| InChI | InChI=1S/C12H11ClN4O2S/c13-11-14-10(9-2-1-8(7-18)20-9)15-12(16-11)17-3-5-19-6-4-17/h1-2,7H,3-6H2 |
| InChIKey | XJENRRCSXAHJCH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|