C30H27F2N3O5SSi — CID 165391734
2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-7,9-difluoro-1-(2-trimethylsilylethoxymethyl)chromeno[4,3-b]pyrrol-4-one (PubChem CID 165391734) has the molecular formula C30H27F2N3O5SSi and a molecular weight of 607.71 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-7,9-difluoro-1-(2-trimethylsilylethoxymethyl)chromeno[4,3-b]pyrrol-4-one.
| Compound Name | 2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-7,9-difluoro-1-(2-trimethylsilylethoxymethyl)chromeno[4,3-b]pyrrol-4-one |
|---|---|
| PubChem CID | 165391734 |
| Molecular Formula | C30H27F2N3O5SSi |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.14 |
| IUPAC Name | 2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-7,9-difluoro-1-(2-trimethylsilylethoxymethyl)chromeno[4,3-b]pyrrol-4-one |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccnc3c2ccn3S(=O)(=O)c2ccccc2)cc2c(=O)oc3cc(F)cc(F)c3c21 |
| InChI | InChI=1S/C30H27F2N3O5SSi/c1-42(2,3)14-13-39-18-34-25(17-23-28(34)27-24(32)15-19(31)16-26(27)40-30(23)36)21-9-11-33-29-22(21)10-12-35(29)41(37,38)20-7-5-4-6-8-20/h4-12,15-17H,13-14,18H2,1-3H3 |
| InChIKey | RAOGKYZTPAOOSN-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 96.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|