C31H30FN3O6SSi — CID 165391741
2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-9-fluoro-8-methoxy-1-(2-trimethylsilylethoxymethyl)chromeno[4,3-b]pyrrol-4-one (PubChem CID 165391741) has the molecular formula C31H30FN3O6SSi and a molecular weight of 619.75 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-9-fluoro-8-methoxy-1-(2-trimethylsilylethoxymethyl)chromeno[4,3-b]pyrrol-4-one.
| Compound Name | 2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-9-fluoro-8-methoxy-1-(2-trimethylsilylethoxymethyl)chromeno[4,3-b]pyrrol-4-one |
|---|---|
| PubChem CID | 165391741 |
| Molecular Formula | C31H30FN3O6SSi |
| Molecular Weight | 619.75 g/mol |
| Exact Mass | 619.16 |
| IUPAC Name | 2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-9-fluoro-8-methoxy-1-(2-trimethylsilylethoxymethyl)chromeno[4,3-b]pyrrol-4-one |
| SMILES | COc1ccc2oc(=O)c3cc(-c4ccnc5c4ccn5S(=O)(=O)c4ccccc4)n(COCC[Si](C)(C)C)c3c2c1F |
| InChI | InChI=1S/C31H30FN3O6SSi/c1-39-26-11-10-25-27(28(26)32)29-23(31(36)41-25)18-24(34(29)19-40-16-17-43(2,3)4)21-12-14-33-30-22(21)13-15-35(30)42(37,38)20-8-6-5-7-9-20/h5-15,18H,16-17,19H2,1-4H3 |
| InChIKey | VBAJIVPHPLPPQC-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 105.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.75 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|