C32H30F3N3O5SSi — CID 165391842
2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-7-methyl-9-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)chromeno[4,3-b]pyrrol-4-one (PubChem CID 165391842) has the molecular formula C32H30F3N3O5SSi and a molecular weight of 653.76 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-7-methyl-9-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)chromeno[4,3-b]pyrrol-4-one.
| Compound Name | 2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-7-methyl-9-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)chromeno[4,3-b]pyrrol-4-one |
|---|---|
| PubChem CID | 165391842 |
| Molecular Formula | C32H30F3N3O5SSi |
| Molecular Weight | 653.76 g/mol |
| Exact Mass | 653.16 |
| IUPAC Name | 2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-7-methyl-9-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)chromeno[4,3-b]pyrrol-4-one |
| SMILES | Cc1cc(C(F)(F)F)c2c(c1)oc(=O)c1cc(-c3ccnc4c3ccn4S(=O)(=O)c3ccccc3)n(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C32H30F3N3O5SSi/c1-20-16-25(32(33,34)35)28-27(17-20)43-31(39)24-18-26(37(29(24)28)19-42-14-15-45(2,3)4)22-10-12-36-30-23(22)11-13-38(30)44(40,41)21-8-6-5-7-9-21/h5-13,16-18H,14-15,19H2,1-4H3 |
| InChIKey | JSOWELOJBNQCDL-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 96.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.76 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|