C23H17Cl2N3O4 — CID 16539320
3-[2-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-4-oxophthalazine-1-carboxylic acid (PubChem CID 16539320) has the molecular formula C23H17Cl2N3O4 and a molecular weight of 470.31 g/mol. Its IUPAC name is 3-[2-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-4-oxophthalazine-1-carboxylic acid.
| Compound Name | 3-[2-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-4-oxophthalazine-1-carboxylic acid |
|---|---|
| PubChem CID | 16539320 |
| Molecular Formula | C23H17Cl2N3O4 |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 3-[2-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-4-oxophthalazine-1-carboxylic acid |
| SMILES | Cc1cc(C(=O)Cn2nc(C(=O)O)c3ccccc3c2=O)c(C)n1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H17Cl2N3O4/c1-12-7-19(13(2)28(12)16-9-14(24)8-15(25)10-16)20(29)11-27-22(30)18-6-4-3-5-17(18)21(26-27)23(31)32/h3-10H,11H2,1-2H3,(H,31,32) |
| InChIKey | HCONCIGMACXPFR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|