C26H28NO — CID 165393562
CID 165393562 (PubChem CID 165393562) has the molecular formula C26H28NO and a molecular weight of 370.52 g/mol.
| Compound Name | CID 165393562 |
|---|---|
| PubChem CID | 165393562 |
| Molecular Formula | C26H28NO |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | — |
| SMILES | C#CC1CCN(C(=O)C(C)C)C1Cc1cccc(C#CC2(C)CC3=C([CH]3)C2)c1 |
| InChI | InChI=1S/C26H28NO/c1-5-21-10-12-27(25(28)18(2)3)24(21)14-20-8-6-7-19(13-20)9-11-26(4)16-22-15-23(22)17-26/h1,6-8,13,15,18,21,24H,10,12,14,16-17H2,2-4H3 |
| InChIKey | GCCIUIFTFCEGCK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|