C22H30N2O4S — CID 175628964
N-[(2R,3R)-1-(2-methylpropanoyl)-2-[[3-[2-(oxetan-3-yl)ethynyl]phenyl]methyl]pyrrolidin-3-yl]ethanesulfonamide (PubChem CID 175628964) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is N-[(2R,3R)-1-(2-methylpropanoyl)-2-[[3-[2-(oxetan-3-yl)ethynyl]phenyl]methyl]pyrrolidin-3-yl]ethanesulfonamide.
| Compound Name | N-[(2R,3R)-1-(2-methylpropanoyl)-2-[[3-[2-(oxetan-3-yl)ethynyl]phenyl]methyl]pyrrolidin-3-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 175628964 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[(2R,3R)-1-(2-methylpropanoyl)-2-[[3-[2-(oxetan-3-yl)ethynyl]phenyl]methyl]pyrrolidin-3-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)N[C@@H]1CCN(C(=O)C(C)C)[C@@H]1Cc1cccc(C#CC2COC2)c1 |
| InChI | InChI=1S/C22H30N2O4S/c1-4-29(26,27)23-20-10-11-24(22(25)16(2)3)21(20)13-18-7-5-6-17(12-18)8-9-19-14-28-15-19/h5-7,12,16,19-21,23H,4,10-11,13-15H2,1-3H3/t20-,21-/m1/s1 |
| InChIKey | BKTVBUXSTWXFAB-NHCUHLMSSA-N |
| XLogP | 1.79 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|