C13H21F3N4O3 — CID 165393968
[(3S)-3-amino-4-[(3S)-2-hydroxypyrrolidin-3-yl]-2-oxobutyl] 3-amino-4,4,4-trifluoro-N-methylbut-2-enimidate (PubChem CID 165393968) has the molecular formula C13H21F3N4O3 and a molecular weight of 338.33 g/mol. Its IUPAC name is [(3S)-3-amino-4-[(3S)-2-hydroxypyrrolidin-3-yl]-2-oxobutyl] 3-amino-4,4,4-trifluoro-N-methylbut-2-enimidate.
| Compound Name | [(3S)-3-amino-4-[(3S)-2-hydroxypyrrolidin-3-yl]-2-oxobutyl] 3-amino-4,4,4-trifluoro-N-methylbut-2-enimidate |
|---|---|
| PubChem CID | 165393968 |
| Molecular Formula | C13H21F3N4O3 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | [(3S)-3-amino-4-[(3S)-2-hydroxypyrrolidin-3-yl]-2-oxobutyl] 3-amino-4,4,4-trifluoro-N-methylbut-2-enimidate |
| SMILES | C/N=C(/C=C(N)C(F)(F)F)OCC(=O)[C@@H](N)C[C@@H]1CCNC1O |
| InChI | InChI=1S/C13H21F3N4O3/c1-19-11(5-10(18)13(14,15)16)23-6-9(21)8(17)4-7-2-3-20-12(7)22/h5,7-8,12,20,22H,2-4,6,17-18H2,1H3/b10-5?,19-11-/t7-,8-,12?/m0/s1 |
| InChIKey | VLUNBUVPSOPBAF-ZXSCIBHCSA-N |
| XLogP | -0.35 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|