C7H8F3IN2 — CID 147169530
4-cyclopropyl-1,1,1-trifluoro-4-iodoiminobut-2-en-2-amine (PubChem CID 147169530) has the molecular formula C7H8F3IN2 and a molecular weight of 304.05 g/mol. Its IUPAC name is 4-cyclopropyl-1,1,1-trifluoro-4-iodoiminobut-2-en-2-amine.
| Compound Name | 4-cyclopropyl-1,1,1-trifluoro-4-iodoiminobut-2-en-2-amine |
|---|---|
| PubChem CID | 147169530 |
| Molecular Formula | C7H8F3IN2 |
| Molecular Weight | 304.05 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 4-cyclopropyl-1,1,1-trifluoro-4-iodoiminobut-2-en-2-amine |
| SMILES | NC(=CC(=NI)C1CC1)C(F)(F)F |
| InChI | InChI=1S/C7H8F3IN2/c8-7(9,10)6(12)3-5(13-11)4-1-2-4/h3-4H,1-2,12H2 |
| InChIKey | AEZUPMWGQKFRGU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.05 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|